![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | society-in-Taygeta-Structure.doc | 2024-11-28 15:25 | 34K | |
![[ ]](/icons/unknown.gif) | samtaleKatteraseET.doc | 2024-11-28 15:25 | 54K | |
![[ ]](/icons/unknown.gif) | religioner etc.doc | 2024-11-28 15:25 | 46K | |
![[ ]](/icons/unknown.gif) | omGrey Aliens_eng-no.doc | 2024-11-28 15:25 | 48K | |
![[ ]](/icons/unknown.gif) | omGraa_1.doc | 2024-11-28 15:25 | 48K | |
![[ ]](/icons/unknown.gif) | den2sferenPadgett.doc | 2024-11-28 15:25 | 37K | |
![[ ]](/icons/unknown.gif) | avhengigheter og astral angrep.doc | 2024-11-28 15:25 | 52K | |
![[ ]](/icons/unknown.gif) | Urmah-intervjuet2no.doc | 2024-11-28 15:25 | 56K | |
![[ ]](/icons/unknown.gif) | The Moon part 3.doc | 2024-11-28 15:25 | 51K | |
![[ ]](/icons/unknown.gif) | The Moon-Part 1.doc | 2024-11-28 15:25 | 47K | |
![[ ]](/icons/unknown.gif) | The Moon, part 4, how it influences Earth’s Matrix, shady things and conclusions.doc | 2024-11-28 15:25 | 50K | |
![[ ]](/icons/unknown.gif) | The Moon, Part 2. Internal structure.doc | 2024-11-28 15:25 | 44K | |
![[ ]](/icons/unknown.gif) | The Astral. Part 3. Important recapitulation of base concepts that describe everything.doc | 2024-11-28 15:25 | 44K | |
![[ ]](/icons/unknown.gif) | The-Astral-Part2.doc | 2024-11-28 15:25 | 33K | |
![[ ]](/icons/unknown.gif) | Telepatiske felt og dine egregors og frykt.doc | 2024-11-28 15:25 | 51K | |
![[ ]](/icons/unknown.gif) | Telepathy.doc | 2024-11-28 15:25 | 52K | |
![[ ]](/icons/unknown.gif) | Telepathic Fields.doc | 2024-11-28 15:25 | 50K | |
![[ ]](/icons/unknown.gif) | Taygeta-origins-and-history.doc | 2024-11-28 15:25 | 37K | |
![[ ]](/icons/unknown.gif) | Swaruu Official.doc | 2024-11-28 15:25 | 49K | |
![[ ]](/icons/unknown.gif) | Swaru-JourneySoFar-2017-23.doc | 2024-11-28 15:25 | 59K | |
![[ ]](/icons/unknown.gif) | Star seeds and their problems. Part 5. Remembering having lived in higher realms.doc | 2024-11-28 15:25 | 46K | |
![[ ]](/icons/unknown.gif) | Star Seeds. Part 8, Astral Projection, Astral Abductions and Night Soul Missions, Part 2.doc | 2024-11-28 15:25 | 34K | |
![[ ]](/icons/unknown.gif) | Star Seeds, Part 7, Astral Projection, Astral Abductions, Night Soul Missions, Part 1.doc | 2024-11-28 15:25 | 43K | |
![[ ]](/icons/unknown.gif) | Pyramids-How Were They Built and What Do They Serve.doc | 2024-11-28 15:25 | 73K | |
![[ ]](/icons/unknown.gif) | Pyramider – hvordan ble de bygget og hva tjener de til.doc | 2024-11-28 15:25 | 82K | |
![[ ]](/icons/unknown.gif) | Pets in Taygeta-Kjæledyr i Taygeta.doc | 2024-11-28 15:25 | 41K | |
![[ ]](/icons/unknown.gif) | New Channel Presentation-om Mari Swaruu-kanalen.doc | 2024-11-28 15:25 | 48K | |
![[ ]](/icons/unknown.gif) | Men in Taygeta.doc | 2024-11-28 15:25 | 34K | |
![[ ]](/icons/unknown.gif) | Media communication in Taygeta.doc | 2024-11-28 15:25 | 31K | |
![[ ]](/icons/unknown.gif) | Light Beings, Demons, Part 4-Possessions and Star Seeds.doc | 2024-11-28 15:25 | 41K | |
![[ ]](/icons/unknown.gif) | Light Beings, Demons, Part 4, Religion, Possessions and Star Seeds.doc | 2024-11-28 15:25 | 41K | |
![[ ]](/icons/unknown.gif) | LEMURIAN SHIP ARRIVING TO EARTH TIMELINE.doc | 2024-11-28 15:25 | 34K | |
![[ ]](/icons/unknown.gif) | Kassia speaks directly to those who remember.doc | 2024-11-28 15:25 | 46K | |
![[ ]](/icons/unknown.gif) | Jesus-Lived-in-India.doc | 2024-11-28 15:25 | 56K | |
![[ ]](/icons/unknown.gif) | Is removing the Cabal advisable.doc | 2024-11-28 15:25 | 35K | |
![[ ]](/icons/unknown.gif) | Invaded-Planets.doc | 2024-11-28 15:25 | 33K | |
![[ ]](/icons/unknown.gif) | HIDDEN-SYMBOLOGY-TIAHUANACO-SUMER- EGYPT.doc | 2024-11-28 15:25 | 21K | |
![[ ]](/icons/unknown.gif) | First Ancient Battle.doc | 2024-11-28 15:25 | 55K | |
![[ ]](/icons/unknown.gif) | Federation about Earth Affairs Early 2024.doc | 2024-11-28 15:25 | 34K | |
![[ ]](/icons/unknown.gif) | Federation-permissive-towards-humanity-problems.doc | 2024-11-28 15:25 | 36K | |
![[ ]](/icons/unknown.gif) | False Alien Invasion-Another Warning, mostly for Star Seeds.doc | 2024-11-28 15:25 | 54K | |
![[ ]](/icons/unknown.gif) | Extraterrestrial Engineering - Reactors-Plasma Engines.doc | 2024-11-28 15:25 | 3.2M | |
![[ ]](/icons/unknown.gif) | Extractions and their problems Part 2.doc | 2024-11-28 15:25 | 30K | |
![[ ]](/icons/unknown.gif) | Extractions and their problems. Part 1.doc | 2024-11-28 15:25 | 47K | |
![[ ]](/icons/unknown.gif) | Extractions and their problems-eng-no.doc | 2024-11-28 15:25 | 48K | |
![[ ]](/icons/unknown.gif) | EXTRACTIONS AND THEIR PROBLEMS3.doc | 2024-11-28 15:25 | 55K | |
![[ ]](/icons/unknown.gif) | Drømmer og mørke nedre astrale entitetsbesøk.doc | 2024-11-28 15:25 | 58K | |
![[ ]](/icons/unknown.gif) | Demons and Evil Entities of the Lower Astral Part 2.doc | 2024-11-28 15:25 | 49K | |
![[ ]](/icons/unknown.gif) | Demons and Evil Entities of the Lower Astral.doc | 2024-11-28 15:25 | 32K | |
![[ ]](/icons/unknown.gif) | Collective Unconscious.doc | 2024-11-28 15:25 | 35K | |
![[ ]](/icons/unknown.gif) | BigFoot.doc | 2024-11-28 15:25 | 56K | |
![[ ]](/icons/unknown.gif) | Attachments and Infestations3.doc | 2024-11-28 15:25 | 55K | |
![[ ]](/icons/unknown.gif) | Artificial Intelligence and the Astral.doc | 2024-11-28 15:25 | 77K | |
![[ ]](/icons/unknown.gif) | AlphaCentauri-Historical-Lies.doc | 2024-11-28 15:25 | 67K | |
![[ ]](/icons/unknown.gif) | ATHENA-SWARUU-sp-sv.doc | 2024-11-28 15:25 | 155K | |
![[ ]](/icons/unknown.gif) | A Perfect Example of how a Soul becomes Strongly Attached to its past life.doc | 2024-11-28 15:25 | 42K | |
![[ ]](/icons/unknown.gif) | 3D-mentalitet og tendensen til å tenke begrenset.doc | 2024-11-28 15:25 | 43K | |
![[ ]](/icons/unknown.gif) | ’Påliminger’ og angrep, del 4, lavere astral, ideer og programmering.doc | 2024-11-28 15:25 | 49K | |
|